C20H20F3NO2S — CID 122045222
(3aS,6aR)-2-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122045222) has the molecular formula C20H20F3NO2S and a molecular weight of 395.45 g/mol. Its IUPAC name is (3aS,6aR)-2-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122045222 |
| Molecular Formula | C20H20F3NO2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (3aS,6aR)-2-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(Cc1ccc(-c3ccc(C(F)(F)F)cc3)s1)C2 |
| InChI | InChI=1S/C20H20F3NO2S/c21-20(22,23)14-5-3-13(4-6-14)17-8-7-16(27-17)11-24-10-15-2-1-9-19(15,12-24)18(25)26/h3-8,15H,1-2,9-12H2,(H,25,26)/t15-,19+/m0/s1 |
| InChIKey | VDOGDFHBILRHNM-HNAYVOBHSA-N |
| XLogP | 5.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |