C19H24N2O2 — CID 122045793
4-[1-(4-methyl-2-pyridinyl)ethylamino]-5-phenylpentanoic acid (PubChem CID 122045793) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-[1-(4-methyl-2-pyridinyl)ethylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[1-(4-methyl-2-pyridinyl)ethylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122045793 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-[1-(4-methyl-2-pyridinyl)ethylamino]-5-phenylpentanoic acid |
| SMILES | Cc1ccnc(C(C)NC(CCC(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-14-10-11-20-18(12-14)15(2)21-17(8-9-19(22)23)13-16-6-4-3-5-7-16/h3-7,10-12,15,17,21H,8-9,13H2,1-2H3,(H,22,23) |
| InChIKey | YREMMCYWSZACAN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |