C19H29NO4 — CID 122046318
1-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122046318) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122046318 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[[3-ethoxy-4-(2-methylpropoxy)phenyl]methyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCOc1cc(CN2CCC(C)(C(=O)O)C2)ccc1OCC(C)C |
| InChI | InChI=1S/C19H29NO4/c1-5-23-17-10-15(6-7-16(17)24-12-14(2)3)11-20-9-8-19(4,13-20)18(21)22/h6-7,10,14H,5,8-9,11-13H2,1-4H3,(H,21,22) |
| InChIKey | OVBDNMFMIHVJNE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |