C16H21N5O2S — CID 122046659
7-[(2-cyclopentyl-1,3-thiazol-5-yl)methyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid (PubChem CID 122046659) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 7-[(2-cyclopentyl-1,3-thiazol-5-yl)methyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid.
| Compound Name | 7-[(2-cyclopentyl-1,3-thiazol-5-yl)methyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 122046659 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 7-[(2-cyclopentyl-1,3-thiazol-5-yl)methyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
| SMILES | Cc1nnc2n1CC(C(=O)O)N(Cc1cnc(C3CCCC3)s1)C2 |
| InChI | InChI=1S/C16H21N5O2S/c1-10-18-19-14-9-20(13(16(22)23)8-21(10)14)7-12-6-17-15(24-12)11-4-2-3-5-11/h6,11,13H,2-5,7-9H2,1H3,(H,22,23) |
| InChIKey | HVDCGSLJXIYYFJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |