C14H13F3N4O2 — CID 122046657
3-methyl-7-[(2,4,5-trifluorophenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid (PubChem CID 122046657) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 3-methyl-7-[(2,4,5-trifluorophenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid.
| Compound Name | 3-methyl-7-[(2,4,5-trifluorophenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 122046657 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-methyl-7-[(2,4,5-trifluorophenyl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
| SMILES | Cc1nnc2n1CC(C(=O)O)N(Cc1cc(F)c(F)cc1F)C2 |
| InChI | InChI=1S/C14H13F3N4O2/c1-7-18-19-13-6-20(12(14(22)23)5-21(7)13)4-8-2-10(16)11(17)3-9(8)15/h2-3,12H,4-6H2,1H3,(H,22,23) |
| InChIKey | SKBDSRIWHUXQGO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|