C17H20Cl2N4O2 — CID 122046586
7-[4-(3,4-dichlorophenyl)butyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid (PubChem CID 122046586) has the molecular formula C17H20Cl2N4O2 and a molecular weight of 383.28 g/mol. Its IUPAC name is 7-[4-(3,4-dichlorophenyl)butyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid.
| Compound Name | 7-[4-(3,4-dichlorophenyl)butyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
|---|---|
| PubChem CID | 122046586 |
| Molecular Formula | C17H20Cl2N4O2 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 7-[4-(3,4-dichlorophenyl)butyl]-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylic acid |
| SMILES | Cc1nnc2n1CC(C(=O)O)N(CCCCc1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C17H20Cl2N4O2/c1-11-20-21-16-10-22(15(17(24)25)9-23(11)16)7-3-2-4-12-5-6-13(18)14(19)8-12/h5-6,8,15H,2-4,7,9-10H2,1H3,(H,24,25) |
| InChIKey | SFJKNNXNLHCJDL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|