C17H17F3N4O2 — CID 122047593
5-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 122047593) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 5-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047593 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 5-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCN(Cc3cccc(C(F)(F)F)c3)CC2)cn1 |
| InChI | InChI=1S/C17H17F3N4O2/c18-17(19,20)13-3-1-2-12(8-13)11-23-4-6-24(7-5-23)15-10-21-14(9-22-15)16(25)26/h1-3,8-10H,4-7,11H2,(H,25,26) |
| InChIKey | NWMQMHAAVFWLLF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |