5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid

C15H17N3O2 — CID 122047926

IUPAC5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid
SMILESCc1ccc(C(C)Nc2cnc(C(=O)O)cn2)cc1C
InChIInChI=1S/C15H17N3O2/c1-9-4-5-12(6-10(9)2)11(3)18-14-8-16-13(7-17-14)15(19)20/h4-8,11H,1-3H3,(H,17,18)(H,19,20)
InChIKeyQOYQUVZXWVSRMN-UHFFFAOYSA-N
MW271.32 g/mol
LogP2.96
Rot. Bonds4

About 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid

5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid (PubChem CID 122047926) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid.

Molecular Properties

Compound Name5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid
PubChem CID122047926
Molecular FormulaC15H17N3O2
Molecular Weight271.32 g/mol
Exact Mass271.13
IUPAC Name5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid
SMILESCc1ccc(C(C)Nc2cnc(C(=O)O)cn2)cc1C
InChIInChI=1S/C15H17N3O2/c1-9-4-5-12(6-10(9)2)11(3)18-14-8-16-13(7-17-14)15(19)20/h4-8,11H,1-3H3,(H,17,18)(H,19,20)
InChIKeyQOYQUVZXWVSRMN-UHFFFAOYSA-N
XLogP2.96
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.32
LogP ≤ 52.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid?
The IUPAC name of 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid (CID 122047926) is 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid?
The canonical SMILES for 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid is Cc1ccc(C(C)Nc2cnc(C(=O)O)cn2)cc1C.
What is the InChIKey of 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid?
The InChIKey is QOYQUVZXWVSRMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-9-4-5-12(6-10(9)2)11(3)18-14-8-16-13(7-17-14)15(19)20/h4-8,11H,1-3H3,(H,17,18)(H,19,20).
What are the key properties of 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid?
5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid has a molecular weight of 271.32 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(3,4-dimethylphenyl)ethylamino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 122047926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).