C18H22N4O2 — CID 122047934
5-[(1-benzylpiperidin-2-yl)methylamino]pyrazine-2-carboxylic acid (PubChem CID 122047934) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-[(1-benzylpiperidin-2-yl)methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(1-benzylpiperidin-2-yl)methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047934 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-[(1-benzylpiperidin-2-yl)methylamino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCC2CCCCN2Cc2ccccc2)cn1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(24)16-11-21-17(12-19-16)20-10-15-8-4-5-9-22(15)13-14-6-2-1-3-7-14/h1-3,6-7,11-12,15H,4-5,8-10,13H2,(H,20,21)(H,23,24) |
| InChIKey | QJSJKNARTFAEBB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |