C17H21N7 — CID 133274813
N-[(1-benzylpiperidin-2-yl)methyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 133274813) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-2-yl)methyl]tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-[(1-benzylpiperidin-2-yl)methyl]tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133274813 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[(1-benzylpiperidin-2-yl)methyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | c1ccc(CN2CCCCC2CNc2ccc3nnnn3n2)cc1 |
| InChI | InChI=1S/C17H21N7/c1-2-6-14(7-3-1)13-23-11-5-4-8-15(23)12-18-16-9-10-17-19-21-22-24(17)20-16/h1-3,6-7,9-10,15H,4-5,8,11-13H2,(H,18,20) |
| InChIKey | FSGULAYDACFIGD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |