C18H22N4O2 — CID 122048029
5-(4-benzyl-3,3-dimethylpiperazin-1-yl)pyrazine-2-carboxylic acid (PubChem CID 122048029) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 5-(4-benzyl-3,3-dimethylpiperazin-1-yl)pyrazine-2-carboxylic acid.
| Compound Name | 5-(4-benzyl-3,3-dimethylpiperazin-1-yl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122048029 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 5-(4-benzyl-3,3-dimethylpiperazin-1-yl)pyrazine-2-carboxylic acid |
| SMILES | CC1(C)CN(c2cnc(C(=O)O)cn2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c1-18(2)13-21(16-11-19-15(10-20-16)17(23)24)8-9-22(18)12-14-6-4-3-5-7-14/h3-7,10-11H,8-9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | MUSZCDBHHIJXPC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |