C9H14N2O2S — CID 122048185
3-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 122048185) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid.
| Compound Name | 3-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122048185 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid |
| SMILES | CC(C)c1cnc(NCCC(=O)O)s1 |
| InChI | InChI=1S/C9H14N2O2S/c1-6(2)7-5-11-9(14-7)10-4-3-8(12)13/h5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | HSDYTXWTQJRGFQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |