C13H17N3O2 — CID 122049271
(2R)-2-[(2-cyano-6-methyl-4-pyridinyl)amino]-4-methylpentanoic acid (PubChem CID 122049271) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (2R)-2-[(2-cyano-6-methyl-4-pyridinyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2-cyano-6-methyl-4-pyridinyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122049271 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2R)-2-[(2-cyano-6-methyl-4-pyridinyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1cc(N[C@H](CC(C)C)C(=O)O)cc(C#N)n1 |
| InChI | InChI=1S/C13H17N3O2/c1-8(2)4-12(13(17)18)16-10-5-9(3)15-11(6-10)7-14/h5-6,8,12H,4H2,1-3H3,(H,15,16)(H,17,18)/t12-/m1/s1 |
| InChIKey | BDQAWKOYNYTWAQ-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |