C13H14F3N3O2 — CID 120964143
(2R)-2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]-4-methylpentanoic acid (PubChem CID 120964143) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is (2R)-2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120964143 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2R)-2-[[3-cyano-6-(trifluoromethyl)-2-pyridinyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](Nc1nc(C(F)(F)F)ccc1C#N)C(=O)O |
| InChI | InChI=1S/C13H14F3N3O2/c1-7(2)5-9(12(20)21)18-11-8(6-17)3-4-10(19-11)13(14,15)16/h3-4,7,9H,5H2,1-2H3,(H,18,19)(H,20,21)/t9-/m1/s1 |
| InChIKey | LBFATZAMNGYUHI-SECBINFHSA-N |
| XLogP | 2.88 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |