C15H23N5O3 — CID 122050080
(2S)-4-methyl-2-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]pentanoic acid (PubChem CID 122050080) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122050080 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2S)-4-methyl-2-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](Nc1cc(N2CCN(C)C(=O)C2)ncn1)C(=O)O |
| InChI | InChI=1S/C15H23N5O3/c1-10(2)6-11(15(22)23)18-12-7-13(17-9-16-12)20-5-4-19(3)14(21)8-20/h7,9-11H,4-6,8H2,1-3H3,(H,22,23)(H,16,17,18)/t11-/m0/s1 |
| InChIKey | VLPLTTVCEGZFLS-NSHDSACASA-N |
| XLogP | 0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |