C17H26N6O2 — CID 133492568
N-[3-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide (PubChem CID 133492568) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-[3-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 133492568 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-[3-[[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]amino]propyl]cyclobutanecarboxamide |
| SMILES | CN1CCN(c2cc(NCCCNC(=O)C3CCC3)ncn2)CC1=O |
| InChI | InChI=1S/C17H26N6O2/c1-22-8-9-23(11-16(22)24)15-10-14(20-12-21-15)18-6-3-7-19-17(25)13-4-2-5-13/h10,12-13H,2-9,11H2,1H3,(H,19,25)(H,18,20,21) |
| InChIKey | TYYXEGNDCXBXOK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|