C15H18N2O2S — CID 122050622
(2R)-3-phenyl-2-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid (PubChem CID 122050622) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122050622 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (2R)-3-phenyl-2-[(5-propan-2-yl-1,3-thiazol-2-yl)amino]propanoic acid |
| SMILES | CC(C)c1cnc(N[C@H](Cc2ccccc2)C(=O)O)s1 |
| InChI | InChI=1S/C15H18N2O2S/c1-10(2)13-9-16-15(20-13)17-12(14(18)19)8-11-6-4-3-5-7-11/h3-7,9-10,12H,8H2,1-2H3,(H,16,17)(H,18,19)/t12-/m1/s1 |
| InChIKey | OAYSPYHENSTUCV-GFCCVEGCSA-N |
| XLogP | 3.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |