C14H22N4O3 — CID 122051371
2-[[4-(oxan-3-ylamino)pyrimidin-2-yl]-propylamino]acetic acid (PubChem CID 122051371) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[[4-(oxan-3-ylamino)pyrimidin-2-yl]-propylamino]acetic acid.
| Compound Name | 2-[[4-(oxan-3-ylamino)pyrimidin-2-yl]-propylamino]acetic acid |
|---|---|
| PubChem CID | 122051371 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-[[4-(oxan-3-ylamino)pyrimidin-2-yl]-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)c1nccc(NC2CCCOC2)n1 |
| InChI | InChI=1S/C14H22N4O3/c1-2-7-18(9-13(19)20)14-15-6-5-12(17-14)16-11-4-3-8-21-10-11/h5-6,11H,2-4,7-10H2,1H3,(H,19,20)(H,15,16,17) |
| InChIKey | DJNFYVSFHLZARY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |