C11H14N4O — CID 115372562
N-(oxan-3-yl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372562) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(oxan-3-yl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-(oxan-3-yl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 115372562 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-(oxan-3-yl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1cc2nc(NC3CCCOC3)ccn2n1 |
| InChI | InChI=1S/C11H14N4O/c1-2-9(8-16-7-1)13-10-4-6-15-11(14-10)3-5-12-15/h3-6,9H,1-2,7-8H2,(H,13,14) |
| InChIKey | KHTJVQSCWUFPGB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |