About N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine
N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372297) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 115372297 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1cc2nc(NC3CC3)ccn2n1 |
| InChI | InChI=1S/C9H10N4/c1-2-7(1)11-8-4-6-13-9(12-8)3-5-10-13/h3-7H,1-2H2,(H,11,12) |
| InChIKey | VVNDMKCNSSKFHU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine (CID 115372297) is N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine is c1cc2nc(NC3CC3)ccn2n1.
What is the InChIKey of N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is VVNDMKCNSSKFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-2-7(1)11-8-4-6-13-9(12-8)3-5-10-13/h3-7H,1-2H2,(H,11,12).
What are the key properties of N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine?
N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 174.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 115372297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).