C12H19N3O4 — CID 122054723
5-[2-(3-methoxypropoxy)ethyl-methylamino]pyrazine-2-carboxylic acid (PubChem CID 122054723) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-[2-(3-methoxypropoxy)ethyl-methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[2-(3-methoxypropoxy)ethyl-methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122054723 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-[2-(3-methoxypropoxy)ethyl-methylamino]pyrazine-2-carboxylic acid |
| SMILES | COCCCOCCN(C)c1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C12H19N3O4/c1-15(4-7-19-6-3-5-18-2)11-9-13-10(8-14-11)12(16)17/h8-9H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | MWKXRCYQJOUQAU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|