methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate

C12H18N2O5 — CID 114059688

IUPACmethyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate
SMILESCOCCOCCCOc1cnc(C(=O)OC)cn1
InChIInChI=1S/C12H18N2O5/c1-16-6-7-18-4-3-5-19-11-9-13-10(8-14-11)12(15)17-2/h8-9H,3-7H2,1-2H3
InChIKeyDYIXTSCSRKQCBD-UHFFFAOYSA-N
MW270.28 g/mol
LogP0.70
Rot. Bonds9

About methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate

methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate (PubChem CID 114059688) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate
PubChem CID114059688
Molecular FormulaC12H18N2O5
Molecular Weight270.28 g/mol
Exact Mass270.12
IUPAC Namemethyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate
SMILESCOCCOCCCOc1cnc(C(=O)OC)cn1
InChIInChI=1S/C12H18N2O5/c1-16-6-7-18-4-3-5-19-11-9-13-10(8-14-11)12(15)17-2/h8-9H,3-7H2,1-2H3
InChIKeyDYIXTSCSRKQCBD-UHFFFAOYSA-N
XLogP0.70
TPSA79.77 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 50.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate?
The IUPAC name of methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate (CID 114059688) is methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate?
The canonical SMILES for methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate is COCCOCCCOc1cnc(C(=O)OC)cn1.
What is the InChIKey of methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate?
The InChIKey is DYIXTSCSRKQCBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5/c1-16-6-7-18-4-3-5-19-11-9-13-10(8-14-11)12(15)17-2/h8-9H,3-7H2,1-2H3.
What are the key properties of methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate?
methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 0.70, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboxylate is sourced from PubChem (CID 114059688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).