C15H14N6O2 — CID 122054893
5-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 122054893) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122054893 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | N#Cc1cccc(N2CCN(c3cnc(C(=O)O)cn3)CC2)n1 |
| InChI | InChI=1S/C15H14N6O2/c16-8-11-2-1-3-13(19-11)20-4-6-21(7-5-20)14-10-17-12(9-18-14)15(22)23/h1-3,9-10H,4-7H2,(H,22,23) |
| InChIKey | GAEJMCCEOGANDC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |