C14H14ClN5O2 — CID 122053202
5-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 122053202) has the molecular formula C14H14ClN5O2 and a molecular weight of 319.75 g/mol. Its IUPAC name is 5-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122053202 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCN(c3ncccc3Cl)CC2)cn1 |
| InChI | InChI=1S/C14H14ClN5O2/c15-10-2-1-3-16-13(10)20-6-4-19(5-7-20)12-9-17-11(8-18-12)14(21)22/h1-3,8-9H,4-7H2,(H,21,22) |
| InChIKey | ABQRGUFLBBCMDQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |