C12H16N2O3 — CID 122054965
6-[[(E)-1-hydroxyhex-4-en-2-yl]amino]pyridine-2-carboxylic acid (PubChem CID 122054965) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-[[(E)-1-hydroxyhex-4-en-2-yl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[(E)-1-hydroxyhex-4-en-2-yl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122054965 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 6-[[(E)-1-hydroxyhex-4-en-2-yl]amino]pyridine-2-carboxylic acid |
| SMILES | C/C=C/CC(CO)Nc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C12H16N2O3/c1-2-3-5-9(8-15)13-11-7-4-6-10(14-11)12(16)17/h2-4,6-7,9,15H,5,8H2,1H3,(H,13,14)(H,16,17)/b3-2+ |
| InChIKey | ZDWJJYLCIJMNJH-NSCUHMNNSA-N |
| XLogP | 1.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|