C18H20N2O3 — CID 122055292
2-[methyl(4-phenylbutyl)carbamoyl]pyridine-4-carboxylic acid (PubChem CID 122055292) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[methyl(4-phenylbutyl)carbamoyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[methyl(4-phenylbutyl)carbamoyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 122055292 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[methyl(4-phenylbutyl)carbamoyl]pyridine-4-carboxylic acid |
| SMILES | CN(CCCCc1ccccc1)C(=O)c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C18H20N2O3/c1-20(12-6-5-9-14-7-3-2-4-8-14)17(21)16-13-15(18(22)23)10-11-19-16/h2-4,7-8,10-11,13H,5-6,9,12H2,1H3,(H,22,23) |
| InChIKey | BUKFNHKJKIPKAV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|