C17H19FN2O — CID 63978971
6-fluoro-N-methyl-N-(4-phenylbutyl)pyridine-3-carboxamide (PubChem CID 63978971) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is 6-fluoro-N-methyl-N-(4-phenylbutyl)pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-methyl-N-(4-phenylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63978971 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-fluoro-N-methyl-N-(4-phenylbutyl)pyridine-3-carboxamide |
| SMILES | CN(CCCCc1ccccc1)C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C17H19FN2O/c1-20(17(21)15-10-11-16(18)19-13-15)12-6-5-9-14-7-3-2-4-8-14/h2-4,7-8,10-11,13H,5-6,9,12H2,1H3 |
| InChIKey | ZGYUXLPIFSXGDQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|