C18H22N2O3 — CID 122057074
6-[(5-methoxy-1-phenylpentyl)amino]pyridine-2-carboxylic acid (PubChem CID 122057074) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 6-[(5-methoxy-1-phenylpentyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(5-methoxy-1-phenylpentyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122057074 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 6-[(5-methoxy-1-phenylpentyl)amino]pyridine-2-carboxylic acid |
| SMILES | COCCCCC(Nc1cccc(C(=O)O)n1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-23-13-6-5-10-15(14-8-3-2-4-9-14)19-17-12-7-11-16(20-17)18(21)22/h2-4,7-9,11-12,15H,5-6,10,13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | VPGIMQKKUQUKRZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|