C16H19BrN4O2 — CID 122061609
2-[[3-[(7-bromoquinazolin-4-yl)amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122061609) has the molecular formula C16H19BrN4O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is 2-[[3-[(7-bromoquinazolin-4-yl)amino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[(7-bromoquinazolin-4-yl)amino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122061609 |
| Molecular Formula | C16H19BrN4O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[[3-[(7-bromoquinazolin-4-yl)amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(Nc2ncnc3cc(Br)ccc23)C1 |
| InChI | InChI=1S/C16H19BrN4O2/c1-2-21(8-15(22)23)12-6-11(7-12)20-16-13-4-3-10(17)5-14(13)18-9-19-16/h3-5,9,11-12H,2,6-8H2,1H3,(H,22,23)(H,18,19,20) |
| InChIKey | GAVAMIBBQXSAQW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |