C13H16N4O4 — CID 122062755
(2S)-2-[(6-nitro-1H-benzimidazol-2-yl)amino]hexanoic acid (PubChem CID 122062755) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is (2S)-2-[(6-nitro-1H-benzimidazol-2-yl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(6-nitro-1H-benzimidazol-2-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 122062755 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (2S)-2-[(6-nitro-1H-benzimidazol-2-yl)amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1nc2ccc([N+](=O)[O-])cc2[nH]1)C(=O)O |
| InChI | InChI=1S/C13H16N4O4/c1-2-3-4-10(12(18)19)15-13-14-9-6-5-8(17(20)21)7-11(9)16-13/h5-7,10H,2-4H2,1H3,(H,18,19)(H2,14,15,16)/t10-/m0/s1 |
| InChIKey | ZBCGITPHKJYTPJ-JTQLQIEISA-N |
| XLogP | 2.53 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|