C15H22N4O2 — CID 122063194
(3aS,6aR)-2-(5,6-diethyl-1,2,4-triazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122063194) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (3aS,6aR)-2-(5,6-diethyl-1,2,4-triazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-(5,6-diethyl-1,2,4-triazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122063194 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3aS,6aR)-2-(5,6-diethyl-1,2,4-triazin-3-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CCc1nnc(N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)nc1CC |
| InChI | InChI=1S/C15H22N4O2/c1-3-11-12(4-2)17-18-14(16-11)19-8-10-6-5-7-15(10,9-19)13(20)21/h10H,3-9H2,1-2H3,(H,20,21)/t10-,15+/m0/s1 |
| InChIKey | ANPSFNAPIVWVSV-ZUZCIYMTSA-N |
| XLogP | 1.69 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |