C18H17Cl2N3O3 — CID 122063370
(3aS,6aR)-2-[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122063370) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is (3aS,6aR)-2-[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122063370 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (3aS,6aR)-2-[5-chloro-1-(4-chlorophenyl)-6-oxopyridazin-4-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(c1cnn(-c3ccc(Cl)cc3)c(=O)c1Cl)C2 |
| InChI | InChI=1S/C18H17Cl2N3O3/c19-12-3-5-13(6-4-12)23-16(24)15(20)14(8-21-23)22-9-11-2-1-7-18(11,10-22)17(25)26/h3-6,8,11H,1-2,7,9-10H2,(H,25,26)/t11-,18+/m0/s1 |
| InChIKey | LAQYGMUQTUTZIW-BBATYDOGSA-N |
| XLogP | 3.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |