C16H21Cl2NO2S — CID 120679931
(3aS,6aR)-2-[2-(4-chlorophenyl)sulfanylethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120679931) has the molecular formula C16H21Cl2NO2S and a molecular weight of 362.32 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(4-chlorophenyl)sulfanylethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(4-chlorophenyl)sulfanylethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120679931 |
| Molecular Formula | C16H21Cl2NO2S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (3aS,6aR)-2-[2-(4-chlorophenyl)sulfanylethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@]12CCC[C@H]1CN(CCSc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C16H20ClNO2S.ClH/c17-13-3-5-14(6-4-13)21-9-8-18-10-12-2-1-7-16(12,11-18)15(19)20;/h3-6,12H,1-2,7-11H2,(H,19,20);1H/t12-,16+;/m0./s1 |
| InChIKey | YVASCLWVQCCBCA-CVHDTDHSSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |