C19H21ClN2O3 — CID 120680378
(3aS,6aR)-2-[[5-(4-chlorophenyl)-4-methyl-1,3-oxazol-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120680378) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is (3aS,6aR)-2-[[5-(4-chlorophenyl)-4-methyl-1,3-oxazol-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[5-(4-chlorophenyl)-4-methyl-1,3-oxazol-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120680378 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (3aS,6aR)-2-[[5-(4-chlorophenyl)-4-methyl-1,3-oxazol-2-yl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1nc(CN2C[C@@H]3CCC[C@@]3(C(=O)O)C2)oc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-12-17(13-4-6-15(20)7-5-13)25-16(21-12)10-22-9-14-3-2-8-19(14,11-22)18(23)24/h4-7,14H,2-3,8-11H2,1H3,(H,23,24)/t14-,19+/m0/s1 |
| InChIKey | HVRMISLAVONGGA-IFXJQAMLSA-N |
| XLogP | 3.99 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |