C20H26N2O3S — CID 72883679
(3aS,6aS)-5-(cyclobutanecarbonyl)-2-(2-phenylsulfanylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72883679) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (3aS,6aS)-5-(cyclobutanecarbonyl)-2-(2-phenylsulfanylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aS)-5-(cyclobutanecarbonyl)-2-(2-phenylsulfanylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72883679 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3aS,6aS)-5-(cyclobutanecarbonyl)-2-(2-phenylsulfanylethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(C1CCC1)N1C[C@@H]2CN(CCSc3ccccc3)C[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C20H26N2O3S/c23-18(15-5-4-6-15)22-12-16-11-21(13-20(16,14-22)19(24)25)9-10-26-17-7-2-1-3-8-17/h1-3,7-8,15-16H,4-6,9-14H2,(H,24,25)/t16-,20-/m0/s1 |
| InChIKey | GKECMCRKJVWFDE-JXFKEZNVSA-N |
| XLogP | 2.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |