C16H16N4O2 — CID 122064321
4-[(5-cyanopyrazin-2-yl)amino]-5-phenylpentanoic acid (PubChem CID 122064321) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-[(5-cyanopyrazin-2-yl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(5-cyanopyrazin-2-yl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122064321 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[(5-cyanopyrazin-2-yl)amino]-5-phenylpentanoic acid |
| SMILES | N#Cc1cnc(NC(CCC(=O)O)Cc2ccccc2)cn1 |
| InChI | InChI=1S/C16H16N4O2/c17-9-14-10-19-15(11-18-14)20-13(6-7-16(21)22)8-12-4-2-1-3-5-12/h1-5,10-11,13H,6-8H2,(H,19,20)(H,21,22) |
| InChIKey | KNEFFVIBLRTNGL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |