C14H20N2O3 — CID 122066019
3-[4-(dimethylamino)-2,6-dimethylanilino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066019) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-[4-(dimethylamino)-2,6-dimethylanilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[4-(dimethylamino)-2,6-dimethylanilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066019 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[4-(dimethylamino)-2,6-dimethylanilino]-2-methyl-3-oxopropanoic acid |
| SMILES | Cc1cc(N(C)C)cc(C)c1NC(=O)C(C)C(=O)O |
| InChI | InChI=1S/C14H20N2O3/c1-8-6-11(16(4)5)7-9(2)12(8)15-13(17)10(3)14(18)19/h6-7,10H,1-5H3,(H,15,17)(H,18,19) |
| InChIKey | IYMQXCDQABKWRH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|