C13H15F3N2O4 — CID 122066336
2-methyl-3-oxo-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]propanoic acid (PubChem CID 122066336) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 122066336 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-methyl-3-oxo-3-[2-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethylamino]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCCc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-8(12(20)21)11(19)17-5-4-9-2-3-10(18-6-9)22-7-13(14,15)16/h2-3,6,8H,4-5,7H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | DVNAMAAIHUFDLW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|