C20H25N3O5 — CID 122066754
3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]morpholin-4-yl]-2-methyl-3-oxopropanoic acid (PubChem CID 122066754) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]morpholin-4-yl]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]morpholin-4-yl]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066754 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]morpholin-4-yl]-2-methyl-3-oxopropanoic acid |
| SMILES | COc1cccc(-n2nc(C)c(C3COCCN3C(=O)C(C)C(=O)O)c2C)c1 |
| InChI | InChI=1S/C20H25N3O5/c1-12(20(25)26)19(24)22-8-9-28-11-17(22)18-13(2)21-23(14(18)3)15-6-5-7-16(10-15)27-4/h5-7,10,12,17H,8-9,11H2,1-4H3,(H,25,26) |
| InChIKey | AZLFDLSLNWMJFH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|