About [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone
[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 75473685) has the molecular formula C19H21N5O2
and a molecular weight of 351.41 g/mol. Its IUPAC name is [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone.
Molecular Properties
| Compound Name | [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
| PubChem CID | 75473685 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C1COCCN1C(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C19H21N5O2/c1-13-18(14(2)24(22-13)15-6-4-3-5-7-15)17-12-26-11-10-23(17)19(25)16-8-9-20-21-16/h3-9,17H,10-12H2,1-2H3,(H,20,21) |
| InChIKey | DHQBQKRYFLUOPC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone?
The IUPAC name of [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone (CID 75473685) is [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone.
What is the SMILES notation for [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone?
The canonical SMILES for [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone is Cc1nn(-c2ccccc2)c(C)c1C1COCCN1C(=O)c1ccn[nH]1.
What is the InChIKey of [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone?
The InChIKey is DHQBQKRYFLUOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O2/c1-13-18(14(2)24(22-13)15-6-4-3-5-7-15)17-12-26-11-10-23(17)19(25)16-8-9-20-21-16/h3-9,17H,10-12H2,1-2H3,(H,20,21).
What are the key properties of [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone?
[3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone has a molecular weight of 351.41 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,5-dimethyl-1-phenylpyrazol-4-yl)morpholin-4-yl]-(1H-pyrazol-5-yl)methanone is sourced from PubChem (CID 75473685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).