About 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone
1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone (PubChem CID 75471254) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone |
| PubChem CID | 75471254 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone |
| SMILES | Cc1nn(C)c(C)c1C1COCCN1C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H22N4O2/c1-12-18(13(2)22(3)21-12)17-11-25-9-8-23(17)19(24)16-10-14-6-4-5-7-15(14)20-16/h4-7,10,17,20H,8-9,11H2,1-3H3 |
| InChIKey | YOIDQXCTJXYXSO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone?
The IUPAC name of 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone (CID 75471254) is 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone.
What is the SMILES notation for 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone?
The canonical SMILES for 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone is Cc1nn(C)c(C)c1C1COCCN1C(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone?
The InChIKey is YOIDQXCTJXYXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-12-18(13(2)22(3)21-12)17-11-25-9-8-23(17)19(24)16-10-14-6-4-5-7-15(14)20-16/h4-7,10,17,20H,8-9,11H2,1-3H3.
What are the key properties of 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone?
1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone has a molecular weight of 338.41 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-2-yl-[3-(1,3,5-trimethylpyrazol-4-yl)morpholin-4-yl]methanone is sourced from PubChem (CID 75471254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).