C12H23NO5S — CID 122068314
3-[(3-cyclopentyloxy-2-methylpropyl)sulfonylamino]propanoic acid (PubChem CID 122068314) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[(3-cyclopentyloxy-2-methylpropyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(3-cyclopentyloxy-2-methylpropyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 122068314 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-[(3-cyclopentyloxy-2-methylpropyl)sulfonylamino]propanoic acid |
| SMILES | CC(COC1CCCC1)CS(=O)(=O)NCCC(=O)O |
| InChI | InChI=1S/C12H23NO5S/c1-10(8-18-11-4-2-3-5-11)9-19(16,17)13-7-6-12(14)15/h10-11,13H,2-9H2,1H3,(H,14,15) |
| InChIKey | WYPPSOXUKIDZQR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |