C11H21NO5S — CID 122068754
4-[[1-(methoxymethyl)cyclopropyl]sulfonylamino]-4-methylpentanoic acid (PubChem CID 122068754) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-[[1-(methoxymethyl)cyclopropyl]sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[1-(methoxymethyl)cyclopropyl]sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122068754 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-[[1-(methoxymethyl)cyclopropyl]sulfonylamino]-4-methylpentanoic acid |
| SMILES | COCC1(S(=O)(=O)NC(C)(C)CCC(=O)O)CC1 |
| InChI | InChI=1S/C11H21NO5S/c1-10(2,5-4-9(13)14)12-18(15,16)11(6-7-11)8-17-3/h12H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | VRIYERPEPATSBO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |