C10H15NO5S — CID 122069045
(2S)-3-methyl-2-[(5-methylfuran-2-yl)sulfonylamino]butanoic acid (PubChem CID 122069045) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(5-methylfuran-2-yl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(5-methylfuran-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 122069045 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2S)-3-methyl-2-[(5-methylfuran-2-yl)sulfonylamino]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=O)O)C(C)C)o1 |
| InChI | InChI=1S/C10H15NO5S/c1-6(2)9(10(12)13)11-17(14,15)8-5-4-7(3)16-8/h4-6,9,11H,1-3H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | LDRLFFQFVBXXMU-VIFPVBQESA-N |
| XLogP | 0.98 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |