C14H21NO4S — CID 122069461
(2R)-2-(hexan-3-ylsulfonylamino)-2-phenylacetic acid (PubChem CID 122069461) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (2R)-2-(hexan-3-ylsulfonylamino)-2-phenylacetic acid.
| Compound Name | (2R)-2-(hexan-3-ylsulfonylamino)-2-phenylacetic acid |
|---|---|
| PubChem CID | 122069461 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2R)-2-(hexan-3-ylsulfonylamino)-2-phenylacetic acid |
| SMILES | CCCC(CC)S(=O)(=O)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO4S/c1-3-8-12(4-2)20(18,19)15-13(14(16)17)11-9-6-5-7-10-11/h5-7,9-10,12-13,15H,3-4,8H2,1-2H3,(H,16,17)/t12?,13-/m1/s1 |
| InChIKey | VPAICDSMBWFXHG-ZGTCLIOFSA-N |
| XLogP | 2.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |