C15H17FN2O4S — CID 122071103
4-[(2-cyano-4-fluorophenyl)methylsulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 122071103) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[(2-cyano-4-fluorophenyl)methylsulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-cyano-4-fluorophenyl)methylsulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122071103 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-[(2-cyano-4-fluorophenyl)methylsulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | N#Cc1cc(F)ccc1CS(=O)(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H17FN2O4S/c16-13-4-1-11(12(7-13)8-17)9-23(21,22)18-14-5-2-10(3-6-14)15(19)20/h1,4,7,10,14,18H,2-3,5-6,9H2,(H,19,20) |
| InChIKey | LRRUJNLCGDVXQY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |