C14H25FN2O4S — CID 122072023
2-[cyclopropylmethyl-[3-(4-fluorobutylsulfonylamino)cyclobutyl]amino]acetic acid (PubChem CID 122072023) has the molecular formula C14H25FN2O4S and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-(4-fluorobutylsulfonylamino)cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-(4-fluorobutylsulfonylamino)cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122072023 |
| Molecular Formula | C14H25FN2O4S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-(4-fluorobutylsulfonylamino)cyclobutyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(NS(=O)(=O)CCCCF)C1 |
| InChI | InChI=1S/C14H25FN2O4S/c15-5-1-2-6-22(20,21)16-12-7-13(8-12)17(10-14(18)19)9-11-3-4-11/h11-13,16H,1-10H2,(H,18,19) |
| InChIKey | MRRHVLGUAZGZSG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|