C14H20N2O4S2 — CID 122072028
2-[cyclopropylmethyl-[3-(thiophen-3-ylsulfonylamino)cyclobutyl]amino]acetic acid (PubChem CID 122072028) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-(thiophen-3-ylsulfonylamino)cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-(thiophen-3-ylsulfonylamino)cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122072028 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-(thiophen-3-ylsulfonylamino)cyclobutyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(NS(=O)(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C14H20N2O4S2/c17-14(18)8-16(7-10-1-2-10)12-5-11(6-12)15-22(19,20)13-3-4-21-9-13/h3-4,9-12,15H,1-2,5-8H2,(H,17,18) |
| InChIKey | MEFRJMNBEKFNRJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |