C17H23N3O6S — CID 122071861
2-[cyclopropylmethyl-[3-[(3-methyl-4-nitrophenyl)sulfonylamino]cyclobutyl]amino]acetic acid (PubChem CID 122071861) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(3-methyl-4-nitrophenyl)sulfonylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(3-methyl-4-nitrophenyl)sulfonylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122071861 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(3-methyl-4-nitrophenyl)sulfonylamino]cyclobutyl]amino]acetic acid |
| SMILES | Cc1cc(S(=O)(=O)NC2CC(N(CC(=O)O)CC3CC3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N3O6S/c1-11-6-15(4-5-16(11)20(23)24)27(25,26)18-13-7-14(8-13)19(10-17(21)22)9-12-2-3-12/h4-6,12-14,18H,2-3,7-10H2,1H3,(H,21,22) |
| InChIKey | UPNXVIDITVLMTG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|