C19H28N2O4S — CID 122071721
2-[cyclopropylmethyl-[3-[(4-propan-2-ylphenyl)sulfonylamino]cyclobutyl]amino]acetic acid (PubChem CID 122071721) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(4-propan-2-ylphenyl)sulfonylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(4-propan-2-ylphenyl)sulfonylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122071721 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(4-propan-2-ylphenyl)sulfonylamino]cyclobutyl]amino]acetic acid |
| SMILES | CC(C)c1ccc(S(=O)(=O)NC2CC(N(CC(=O)O)CC3CC3)C2)cc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-13(2)15-5-7-18(8-6-15)26(24,25)20-16-9-17(10-16)21(12-19(22)23)11-14-3-4-14/h5-8,13-14,16-17,20H,3-4,9-12H2,1-2H3,(H,22,23) |
| InChIKey | XAXPAOIEAFMYPH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |